C21H23N5O4 — CID 118036273
N-(5-cyano-4-ethyl-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036273) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-(5-cyano-4-ethyl-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-(5-cyano-4-ethyl-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036273 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-(5-cyano-4-ethyl-2-pyridinyl)-7-(dimethoxymethyl)-6-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | CCc1cc(NC(=O)N2CCCc3cc(C=O)c(C(OC)OC)nc32)ncc1C#N |
| InChI | InChI=1S/C21H23N5O4/c1-4-13-9-17(23-11-16(13)10-22)24-21(28)26-7-5-6-14-8-15(12-27)18(25-19(14)26)20(29-2)30-3/h8-9,11-12,20H,4-7H2,1-3H3,(H,23,24,28) |
| InChIKey | YDQCUZXTZJHIGU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|