C23H23N7O3S — CID 118036277
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036277) has the molecular formula C23H23N7O3S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036277 |
| Molecular Formula | C23H23N7O3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(-c4cnc(C)s4)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C23H23N7O3S/c1-14-26-12-20(34-14)17-8-15-4-3-6-30(22(15)28-19(17)13-31)23(32)29-21-9-18(25-5-7-33-2)16(10-24)11-27-21/h8-9,11-13H,3-7H2,1-2H3,(H2,25,27,29,32) |
| InChIKey | RXONHZJFUFKCMG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|