C18H27F2N3O2 — CID 118036353
6-[1-(2,2-difluoroethyl)piperidin-4-yl]-7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 118036353) has the molecular formula C18H27F2N3O2 and a molecular weight of 355.43 g/mol. Its IUPAC name is 6-[1-(2,2-difluoroethyl)piperidin-4-yl]-7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 6-[1-(2,2-difluoroethyl)piperidin-4-yl]-7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 118036353 |
| Molecular Formula | C18H27F2N3O2 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 6-[1-(2,2-difluoroethyl)piperidin-4-yl]-7-(dimethoxymethyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | COC(OC)c1nc2c(cc1C1CCN(CC(F)F)CC1)CCCN2 |
| InChI | InChI=1S/C18H27F2N3O2/c1-24-18(25-2)16-14(10-13-4-3-7-21-17(13)22-16)12-5-8-23(9-6-12)11-15(19)20/h10,12,15,18H,3-9,11H2,1-2H3,(H,21,22) |
| InChIKey | BDFCTOWNGYVATK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|