About N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate
N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate (PubChem CID 118036431) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate.
Molecular Properties
| Compound Name | N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate |
| PubChem CID | 118036431 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate |
| SMILES | CC1C[C@H](NC(=O)[O-])[C@H](N=[N+]=N)CO1 |
| InChI | InChI=1S/C7H12N4O3/c1-4-2-5(9-7(12)13)6(3-14-4)10-11-8/h4-6,8-9H,2-3H2,1H3/t4?,5-,6+/m0/s1 |
| InChIKey | DOHFLFRTWAVJMB-DUAGOPDLSA-N |
| XLogP | -0.98 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate?
The IUPAC name of N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate (CID 118036431) is N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate.
What is the SMILES notation for N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate?
The canonical SMILES for N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate is CC1C[C@H](NC(=O)[O-])[C@H](N=[N+]=N)CO1.
What is the InChIKey of N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate?
The InChIKey is DOHFLFRTWAVJMB-DUAGOPDLSA-N. The full InChI is InChI=1S/C7H12N4O3/c1-4-2-5(9-7(12)13)6(3-14-4)10-11-8/h4-6,8-9H,2-3H2,1H3/t4?,5-,6+/m0/s1.
What are the key properties of N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate?
N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate has a molecular weight of 200.20 g/mol, XLogP of -0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S,5S)-5-(iminoazaniumylideneamino)-2-methyloxan-4-yl]carbamate is sourced from PubChem (CID 118036431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).