C15H12N6O2 — CID 118036466
N-(5-cyanopyrimidin-2-yl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036466) has the molecular formula C15H12N6O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-(5-cyanopyrimidin-2-yl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-(5-cyanopyrimidin-2-yl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036466 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(5-cyanopyrimidin-2-yl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | N#Cc1cnc(NC(=O)N2CCCc3ccc(C=O)nc32)nc1 |
| InChI | InChI=1S/C15H12N6O2/c16-6-10-7-17-14(18-8-10)20-15(23)21-5-1-2-11-3-4-12(9-22)19-13(11)21/h3-4,7-9H,1-2,5H2,(H,17,18,20,23) |
| InChIKey | ILTDXKXOGRYYPI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|