C20H20F2N6O3 — CID 118036468
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(difluoromethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036468) has the molecular formula C20H20F2N6O3 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(difluoromethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(difluoromethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036468 |
| Molecular Formula | C20H20F2N6O3 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(difluoromethyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(C(F)F)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C20H20F2N6O3/c1-31-6-4-24-15-8-17(25-10-13(15)9-23)27-20(30)28-5-2-3-12-7-14(18(21)22)16(11-29)26-19(12)28/h7-8,10-11,18H,2-6H2,1H3,(H2,24,25,27,30) |
| InChIKey | DZGMBBPPVCVYNF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|