About 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline
2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline (PubChem CID 118036511) has the molecular formula C16H10Cl3FN2O2
and a molecular weight of 387.63 g/mol. Its IUPAC name is 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline.
Molecular Properties
| Compound Name | 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline |
| PubChem CID | 118036511 |
| Molecular Formula | C16H10Cl3FN2O2 |
| Molecular Weight | 387.63 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3nc(Cl)ncc3c2F)c1Cl |
| InChI | InChI=1S/C16H10Cl3FN2O2/c1-23-10-5-11(24-2)14(18)12(13(10)17)7-3-4-9-8(15(7)20)6-21-16(19)22-9/h3-6H,1-2H3 |
| InChIKey | CLVLUGVYIGJVSC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline?
The IUPAC name of 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline (CID 118036511) is 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline.
What is the SMILES notation for 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline?
The canonical SMILES for 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline is COc1cc(OC)c(Cl)c(-c2ccc3nc(Cl)ncc3c2F)c1Cl.
What is the InChIKey of 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline?
The InChIKey is CLVLUGVYIGJVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl3FN2O2/c1-23-10-5-11(24-2)14(18)12(13(10)17)7-3-4-9-8(15(7)20)6-21-16(19)22-9/h3-6H,1-2H3.
What are the key properties of 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline?
2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline has a molecular weight of 387.63 g/mol, XLogP of 5.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(2,6-dichloro-3,5-dimethoxyphenyl)-5-fluoroquinazoline is sourced from PubChem (CID 118036511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).