C26H32F2N6O5 — CID 118036592
N-[5-cyano-4-[2-(oxan-2-yloxy)ethylamino]-2-pyridinyl]-6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036592) has the molecular formula C26H32F2N6O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is N-[5-cyano-4-[2-(oxan-2-yloxy)ethylamino]-2-pyridinyl]-6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-[2-(oxan-2-yloxy)ethylamino]-2-pyridinyl]-6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036592 |
| Molecular Formula | C26H32F2N6O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | N-[5-cyano-4-[2-(oxan-2-yloxy)ethylamino]-2-pyridinyl]-6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COC(OC)c1nc2c(cc1C(F)F)CCCN2C(=O)Nc1cc(NCCOC2CCCCO2)c(C#N)cn1 |
| InChI | InChI=1S/C26H32F2N6O5/c1-36-25(37-2)22-18(23(27)28)12-16-6-5-9-34(24(16)33-22)26(35)32-20-13-19(17(14-29)15-31-20)30-8-11-39-21-7-3-4-10-38-21/h12-13,15,21,23,25H,3-11H2,1-2H3,(H2,30,31,32,35) |
| InChIKey | RSDUQXAVOIVPLG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|