C10H14N4O — CID 118036603
6-amino-4-(2-methoxypropylamino)pyridine-3-carbonitrile (PubChem CID 118036603) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-amino-4-(2-methoxypropylamino)pyridine-3-carbonitrile.
| Compound Name | 6-amino-4-(2-methoxypropylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118036603 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-amino-4-(2-methoxypropylamino)pyridine-3-carbonitrile |
| SMILES | COC(C)CNc1cc(N)ncc1C#N |
| InChI | InChI=1S/C10H14N4O/c1-7(15-2)5-13-9-3-10(12)14-6-8(9)4-11/h3,6-7H,5H2,1-2H3,(H3,12,13,14) |
| InChIKey | XPOSWDOIQDVOKC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |