C17H26N4O3 — CID 118036658
1-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-4-methylpiperazin-2-one (PubChem CID 118036658) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-4-methylpiperazin-2-one.
| Compound Name | 1-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-4-methylpiperazin-2-one |
|---|---|
| PubChem CID | 118036658 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[[2-(dimethoxymethyl)-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]methyl]-4-methylpiperazin-2-one |
| SMILES | COC(OC)c1nc2c(cc1CN1CCN(C)CC1=O)CCCN2 |
| InChI | InChI=1S/C17H26N4O3/c1-20-7-8-21(14(22)11-20)10-13-9-12-5-4-6-18-16(12)19-15(13)17(23-2)24-3/h9,17H,4-8,10-11H2,1-3H3,(H,18,19) |
| InChIKey | GOSYUJDNSJUVHT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|