C23H24N8O3 — CID 118036712
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methylpyrazol-3-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036712) has the molecular formula C23H24N8O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methylpyrazol-3-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methylpyrazol-3-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036712 |
| Molecular Formula | C23H24N8O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(2-methylpyrazol-3-yl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(-c4ccnn4C)c(C=O)nc32)ncc1C#N |
| InChI | InChI=1S/C23H24N8O3/c1-30-20(5-6-27-30)17-10-15-4-3-8-31(22(15)28-19(17)14-32)23(33)29-21-11-18(25-7-9-34-2)16(12-24)13-26-21/h5-6,10-11,13-14H,3-4,7-9H2,1-2H3,(H2,25,26,29,33) |
| InChIKey | XJRREISSIXYRMU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|