C20H20N6O3 — CID 118036769
N-(5-cyano-4-morpholin-4-yl-2-pyridinyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 118036769) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-(5-cyano-4-morpholin-4-yl-2-pyridinyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-(5-cyano-4-morpholin-4-yl-2-pyridinyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 118036769 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(5-cyano-4-morpholin-4-yl-2-pyridinyl)-7-formyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | N#Cc1cnc(NC(=O)N2CCCc3ccc(C=O)nc32)cc1N1CCOCC1 |
| InChI | InChI=1S/C20H20N6O3/c21-11-15-12-22-18(10-17(15)25-6-8-29-9-7-25)24-20(28)26-5-1-2-14-3-4-16(13-27)23-19(14)26/h3-4,10,12-13H,1-2,5-9H2,(H,22,24,28) |
| InChIKey | LLGVSBQJQDXICA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|