C12H10F3NO4 — CID 118037506
2H-chromene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118037506) has the molecular formula C12H10F3NO4 and a molecular weight of 289.21 g/mol. Its IUPAC name is 2H-chromene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2H-chromene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118037506 |
| Molecular Formula | C12H10F3NO4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2H-chromene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)C1=Cc2ccccc2OC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H9NO2.C2HF3O2/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8;3-2(4,5)1(6)7/h1-5H,6H2,(H2,11,12);(H,6,7) |
| InChIKey | BREKONVOQWJLGD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |