C23H23N5O2 — CID 118037587
7-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one (PubChem CID 118037587) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one.
| Compound Name | 7-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 118037587 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 7-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-3-(6,8-dimethylimidazo[1,2-a]pyrazin-2-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5CC[C@H]6CNC[C@H]65)cc4oc3=O)nc2c(C)n1 |
| InChI | InChI=1S/C23H23N5O2/c1-13-11-27-12-19(26-22(27)14(2)25-13)18-7-15-3-4-17(8-21(15)30-23(18)29)28-6-5-16-9-24-10-20(16)28/h3-4,7-8,11-12,16,20,24H,5-6,9-10H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | QMVXWTYGGHBGER-OXJNMPFZSA-N |
| XLogP | 2.92 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|