C39H37ClN8O4 — CID 118037763
3-(2-chloro-4-pyridinyl)-7-piperazin-1-ylchromen-2-one;3-imidazo[1,2-a]pyrimidin-2-yl-7-[methyl-(1-methylpyrrolidin-3-yl)amino]chromen-2-one (PubChem CID 118037763) has the molecular formula C39H37ClN8O4 and a molecular weight of 717.23 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-7-piperazin-1-ylchromen-2-one;3-imidazo[1,2-a]pyrimidin-2-yl-7-[methyl-(1-methylpyrrolidin-3-yl)amino]chromen-2-one.
| Compound Name | 3-(2-chloro-4-pyridinyl)-7-piperazin-1-ylchromen-2-one;3-imidazo[1,2-a]pyrimidin-2-yl-7-[methyl-(1-methylpyrrolidin-3-yl)amino]chromen-2-one |
|---|---|
| PubChem CID | 118037763 |
| Molecular Formula | C39H37ClN8O4 |
| Molecular Weight | 717.23 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-7-piperazin-1-ylchromen-2-one;3-imidazo[1,2-a]pyrimidin-2-yl-7-[methyl-(1-methylpyrrolidin-3-yl)amino]chromen-2-one |
| SMILES | CN1CCC(N(C)c2ccc3cc(-c4cn5cccnc5n4)c(=O)oc3c2)C1.O=c1oc2cc(N3CCNCC3)ccc2cc1-c1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H21N5O2.C18H16ClN3O2/c1-24-9-6-16(12-24)25(2)15-5-4-14-10-17(20(27)28-19(14)11-15)18-13-26-8-3-7-22-21(26)23-18;19-17-10-12(3-4-21-17)15-9-13-1-2-14(11-16(13)24-18(15)23)22-7-5-20-6-8-22/h3-5,7-8,10-11,13,16H,6,9,12H2,1-2H3;1-4,9-11,20H,5-8H2 |
| InChIKey | MATOANVFQQRLEQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|