C23H34F3N3O4 — CID 118037833
3,3-dimethyl-1-[(3R)-3-[[5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]butan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 118037833) has the molecular formula C23H34F3N3O4 and a molecular weight of 473.54 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(3R)-3-[[5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]butan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 3,3-dimethyl-1-[(3R)-3-[[5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]butan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118037833 |
| Molecular Formula | C23H34F3N3O4 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 3,3-dimethyl-1-[(3R)-3-[[5-[(E,4S)-4-(methylamino)pent-1-enyl]-3-pyridinyl]oxy]pyrrolidin-1-yl]butan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | CN[C@@H](C)C/C=C/c1cncc(O[C@@H]2CCN(C(=O)CC(C)(C)C)C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H33N3O2.C2HF3O2/c1-16(22-5)7-6-8-17-11-19(14-23-13-17)26-18-9-10-24(15-18)20(25)12-21(2,3)4;3-2(4,5)1(6)7/h6,8,11,13-14,16,18,22H,7,9-10,12,15H2,1-5H3;(H,6,7)/b8-6+;/t16-,18+;/m0./s1 |
| InChIKey | MMONTRQXEHIGOE-CEBNSKMJSA-N |
| XLogP | 4.14 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |