C18H19FN5O3+ — CID 118038047
1-(5-cyano-4-fluoro-2-pyridinyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118038047) has the molecular formula C18H19FN5O3+ and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-(5-cyano-4-fluoro-2-pyridinyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 1-(5-cyano-4-fluoro-2-pyridinyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118038047 |
| Molecular Formula | C18H19FN5O3+ |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(5-cyano-4-fluoro-2-pyridinyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | COC(OC)c1ccc2c(n1)[N+](C(N)=O)(c1cc(F)c(C#N)cn1)CCC2 |
| InChI | InChI=1S/C18H18FN5O3/c1-26-17(27-2)14-6-5-11-4-3-7-24(18(21)25,16(11)23-14)15-8-13(19)12(9-20)10-22-15/h5-6,8,10,17H,3-4,7H2,1-2H3,(H-,21,25)/p+1 |
| InChIKey | OSIKUADXHWAXGO-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|