C14H26N+ — CID 118038228
9-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole;hydron (PubChem CID 118038228) has the molecular formula C14H26N+ and a molecular weight of 208.37 g/mol. Its IUPAC name is 9-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole;hydron.
| Compound Name | 9-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole;hydron |
|---|---|
| PubChem CID | 118038228 |
| Molecular Formula | C14H26N+ |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.21 |
| IUPAC Name | 9-ethyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole;hydron |
| SMILES | CCN1C2CCCCC2C2CCCCC21.[H+] |
| InChI | InChI=1S/C14H25N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h11-14H,2-10H2,1H3/p+1 |
| InChIKey | FUUPYXUBNPJSOA-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |