C23H24ClN6O4S+ — CID 118038294
1-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118038294) has the molecular formula C23H24ClN6O4S+ and a molecular weight of 516.00 g/mol. Its IUPAC name is 1-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 1-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118038294 |
| Molecular Formula | C23H24ClN6O4S+ |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]-7-formyl-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc([N+]2(C(N)=O)CCCc3ccc(C=O)nc32)ncc1Cl |
| InChI | InChI=1S/C23H23ClN6O4S/c1-14(2)35(33,34)19-8-4-3-7-18(19)28-20-17(24)12-26-23(29-20)30(22(25)32)11-5-6-15-9-10-16(13-31)27-21(15)30/h3-4,7-10,12-14H,5-6,11H2,1-2H3,(H2-,25,26,28,29,32)/p+1 |
| InChIKey | PQCZBQUPGZDHJB-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 145.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|