C42H32Cl2N6O2 — CID 118038327
[2-(benzylamino)-3-pyridinyl]-(6-chloro-1H-indol-3-yl)methanone (PubChem CID 118038327) has the molecular formula C42H32Cl2N6O2 and a molecular weight of 723.66 g/mol. Its IUPAC name is [2-(benzylamino)-3-pyridinyl]-(6-chloro-1H-indol-3-yl)methanone.
| Compound Name | [2-(benzylamino)-3-pyridinyl]-(6-chloro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 118038327 |
| Molecular Formula | C42H32Cl2N6O2 |
| Molecular Weight | 723.66 g/mol |
| Exact Mass | 722.20 |
| IUPAC Name | [2-(benzylamino)-3-pyridinyl]-(6-chloro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1cccnc1NCc1ccccc1)c1c[nH]c2cc(Cl)ccc12.O=C(c1cccnc1NCc1ccccc1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/2C21H16ClN3O/c2*22-15-8-9-16-18(13-24-19(16)11-15)20(26)17-7-4-10-23-21(17)25-12-14-5-2-1-3-6-14/h2*1-11,13,24H,12H2,(H,23,25) |
| InChIKey | GLLRKZBEUKLDHJ-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.66 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |