About 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one
4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one (PubChem CID 118038509) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one |
| PubChem CID | 118038509 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one |
| SMILES | CC(=O)C=C(C)C.CC(=O)CC(C)(C)O.CC(C)=O |
| InChI | InChI=1S/C6H12O2.C6H10O.C3H6O/c1-5(7)4-6(2,3)8;1-5(2)4-6(3)7;1-3(2)4/h8H,4H2,1-3H3;4H,1-3H3;1-2H3 |
| InChIKey | XESQPQOHQVMKFH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one?
The IUPAC name of 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one (CID 118038509) is 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one.
What is the SMILES notation for 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one?
The canonical SMILES for 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one is CC(=O)C=C(C)C.CC(=O)CC(C)(C)O.CC(C)=O.
What is the InChIKey of 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one?
The InChIKey is XESQPQOHQVMKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C6H10O.C3H6O/c1-5(7)4-6(2,3)8;1-5(2)4-6(3)7;1-3(2)4/h8H,4H2,1-3H3;4H,1-3H3;1-2H3.
What are the key properties of 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one?
4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one has a molecular weight of 272.38 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-4-methylpentan-2-one;4-methylpent-3-en-2-one;propan-2-one is sourced from PubChem (CID 118038509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).