C18H20F3N4O3+ — CID 118038613
7-(dimethoxymethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118038613) has the molecular formula C18H20F3N4O3+ and a molecular weight of 397.38 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 7-(dimethoxymethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118038613 |
| Molecular Formula | C18H20F3N4O3+ |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 7-(dimethoxymethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | COC(OC)c1ccc2c(n1)[N+](C(N)=O)(c1ccc(C(F)(F)F)cn1)CCC2 |
| InChI | InChI=1S/C18H19F3N4O3/c1-27-16(28-2)13-7-5-11-4-3-9-25(17(22)26,15(11)24-13)14-8-6-12(10-23-14)18(19,20)21/h5-8,10,16H,3-4,9H2,1-2H3,(H-,22,26)/p+1 |
| InChIKey | RBHLIUNWCCJJQB-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|