C25H32N6O2 — CID 118038619
6-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-2-[4-(2-pyrrolidin-1-ylethyl)anilino]pyridine-3-carboxamide (PubChem CID 118038619) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 6-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-2-[4-(2-pyrrolidin-1-ylethyl)anilino]pyridine-3-carboxamide.
| Compound Name | 6-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-2-[4-(2-pyrrolidin-1-ylethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118038619 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 6-[(3S)-3-(prop-2-enoylamino)pyrrolidin-1-yl]-2-[4-(2-pyrrolidin-1-ylethyl)anilino]pyridine-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCN(c2ccc(C(N)=O)c(Nc3ccc(CCN4CCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C25H32N6O2/c1-2-23(32)27-20-12-16-31(17-20)22-10-9-21(24(26)33)25(29-22)28-19-7-5-18(6-8-19)11-15-30-13-3-4-14-30/h2,5-10,20H,1,3-4,11-17H2,(H2,26,33)(H,27,32)(H,28,29)/t20-/m0/s1 |
| InChIKey | APJMAQHTUILKLX-FQEVSTJZSA-N |
| XLogP | 2.44 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|