C56H52N4O8 — CID 11803863
tetraethyl 6,12,18,24-tetraphenyl-4,10,16,22-tetrazapentacyclo[19.3.0.03,7.09,13.015,19]tetracosa-1(21),3(7),5,9(13),11,15(19),17,23-octaene-5,11,17,23-tetracarboxylate (PubChem CID 11803863) has the molecular formula C56H52N4O8 and a molecular weight of 909.05 g/mol. Its IUPAC name is tetraethyl 6,12,18,24-tetraphenyl-4,10,16,22-tetrazapentacyclo[19.3.0.03,7.09,13.015,19]tetracosa-1(21),3(7),5,9(13),11,15(19),17,23-octaene-5,11,17,23-tetracarboxylate.
| Compound Name | tetraethyl 6,12,18,24-tetraphenyl-4,10,16,22-tetrazapentacyclo[19.3.0.03,7.09,13.015,19]tetracosa-1(21),3(7),5,9(13),11,15(19),17,23-octaene-5,11,17,23-tetracarboxylate |
|---|---|
| PubChem CID | 11803863 |
| Molecular Formula | C56H52N4O8 |
| Molecular Weight | 909.05 g/mol |
| Exact Mass | 908.38 |
| IUPAC Name | tetraethyl 6,12,18,24-tetraphenyl-4,10,16,22-tetrazapentacyclo[19.3.0.03,7.09,13.015,19]tetracosa-1(21),3(7),5,9(13),11,15(19),17,23-octaene-5,11,17,23-tetracarboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(c1-c1ccccc1)Cc1[nH]c(C(=O)OCC)c(-c3ccccc3)c1Cc1[nH]c(C(=O)OCC)c(-c3ccccc3)c1Cc1[nH]c(C(=O)OCC)c(-c3ccccc3)c1C2 |
| InChI | InChI=1S/C56H52N4O8/c1-5-65-53(61)49-45(33-21-13-9-14-22-33)37-29-42-39(47(35-25-17-11-18-26-35)51(58-42)55(63)67-7-3)31-44-40(48(36-27-19-12-20-28-36)52(60-44)56(64)68-8-4)32-43-38(30-41(37)57-49)46(34-23-15-10-16-24-34)50(59-43)54(62)66-6-2/h9-28,57-60H,5-8,29-32H2,1-4H3 |
| InChIKey | XIPGGFSVGUJMDT-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.05 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|