About (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol
(4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol (PubChem CID 118038763) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol |
| PubChem CID | 118038763 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol |
| SMILES | CCN(c1ccccc1)[C@@H]1COC(C)(C)C[C@H]1O |
| InChI | InChI=1S/C15H23NO2/c1-4-16(12-8-6-5-7-9-12)13-11-18-15(2,3)10-14(13)17/h5-9,13-14,17H,4,10-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | BYHZDPLGLHSMCC-ZIAGYGMSSA-N |
| XLogP | 2.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol?
The IUPAC name of (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol (CID 118038763) is (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol.
What is the SMILES notation for (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol?
The canonical SMILES for (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol is CCN(c1ccccc1)[C@@H]1COC(C)(C)C[C@H]1O.
What is the InChIKey of (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol?
The InChIKey is BYHZDPLGLHSMCC-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H23NO2/c1-4-16(12-8-6-5-7-9-12)13-11-18-15(2,3)10-14(13)17/h5-9,13-14,17H,4,10-11H2,1-3H3/t13-,14-/m1/s1.
What are the key properties of (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol?
(4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol has a molecular weight of 249.35 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-5-(N-ethylanilino)-2,2-dimethyloxan-4-ol is sourced from PubChem (CID 118038763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).