C19H22F3N4O3+ — CID 118039100
7-(dimethoxymethyl)-6-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide (PubChem CID 118039100) has the molecular formula C19H22F3N4O3+ and a molecular weight of 411.40 g/mol. Its IUPAC name is 7-(dimethoxymethyl)-6-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide.
| Compound Name | 7-(dimethoxymethyl)-6-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 118039100 |
| Molecular Formula | C19H22F3N4O3+ |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 7-(dimethoxymethyl)-6-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridin-1-ium-1-carboxamide |
| SMILES | COC(OC)c1nc2c(cc1C)CCC[N+]2(C(N)=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H21F3N4O3/c1-11-9-12-5-4-8-26(18(23)27,16(12)25-15(11)17(28-2)29-3)14-7-6-13(10-24-14)19(20,21)22/h6-7,9-10,17H,4-5,8H2,1-3H3,(H-,23,27)/p+1 |
| InChIKey | BHPHLJLVECBMJN-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|