About 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one
5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one (PubChem CID 118039335) has the molecular formula C18H26O9
and a molecular weight of 386.40 g/mol. Its IUPAC name is 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one.
Molecular Properties
| Compound Name | 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one |
| PubChem CID | 118039335 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one |
| SMILES | C=CC(=O)C(O)COCC(COCC(O)C(=O)C=C)OCC(O)C(=O)C=C |
| InChI | InChI=1S/C18H26O9/c1-4-13(19)16(22)9-25-7-12(27-11-18(24)15(21)6-3)8-26-10-17(23)14(20)5-2/h4-6,12,16-18,22-24H,1-3,7-11H2 |
| InChIKey | WUODDBXCFVPJRN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one?
The IUPAC name of 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one (CID 118039335) is 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one.
What is the SMILES notation for 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one?
The canonical SMILES for 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one is C=CC(=O)C(O)COCC(COCC(O)C(=O)C=C)OCC(O)C(=O)C=C.
What is the InChIKey of 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one?
The InChIKey is WUODDBXCFVPJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O9/c1-4-13(19)16(22)9-25-7-12(27-11-18(24)15(21)6-3)8-26-10-17(23)14(20)5-2/h4-6,12,16-18,22-24H,1-3,7-11H2.
What are the key properties of 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one?
5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one has a molecular weight of 386.40 g/mol, XLogP of -1.25, 17 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,3-bis(2-hydroxy-3-oxopent-4-enoxy)propoxy]-4-hydroxypent-1-en-3-one is sourced from PubChem (CID 118039335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).