About 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine
4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine (PubChem CID 118040317) has the molecular formula C21H22N2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine.
Molecular Properties
| Compound Name | 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine |
| PubChem CID | 118040317 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine |
| SMILES | Cc1cc(C)c(Cc2ccncc2)c(C)c1Cc1ccncc1 |
| InChI | InChI=1S/C21H22N2/c1-15-12-16(2)21(14-19-6-10-23-11-7-19)17(3)20(15)13-18-4-8-22-9-5-18/h4-12H,13-14H2,1-3H3 |
| InChIKey | KNGUTJAUDYHCQH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine?
The IUPAC name of 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine (CID 118040317) is 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine.
What is the SMILES notation for 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine?
The canonical SMILES for 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine is Cc1cc(C)c(Cc2ccncc2)c(C)c1Cc1ccncc1.
What is the InChIKey of 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine?
The InChIKey is KNGUTJAUDYHCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2/c1-15-12-16(2)21(14-19-6-10-23-11-7-19)17(3)20(15)13-18-4-8-22-9-5-18/h4-12H,13-14H2,1-3H3.
What are the key properties of 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine?
4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine has a molecular weight of 302.42 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2,4,6-trimethyl-3-(pyridin-4-ylmethyl)phenyl]methyl]pyridine is sourced from PubChem (CID 118040317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).