C25H46OS2 — CID 118040323
thiane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 118040323) has the molecular formula C25H46OS2 and a molecular weight of 426.78 g/mol. Its IUPAC name is thiane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | thiane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 118040323 |
| Molecular Formula | C25H46OS2 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | thiane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | C1CCSCC1.C1CCSCC1.CC(C)=CCCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C15H26O.2C5H10S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;2*1-2-4-6-5-3-1/h7,9,11,16H,5-6,8,10,12H2,1-4H3;2*1-5H2 |
| InChIKey | SKMPJUNOPQKUPI-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|