C21H18ClF3N2O4 — CID 118040636
[2-[[1-(3-chlorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate (PubChem CID 118040636) has the molecular formula C21H18ClF3N2O4 and a molecular weight of 454.83 g/mol. Its IUPAC name is [2-[[1-(3-chlorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate.
| Compound Name | [2-[[1-(3-chlorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118040636 |
| Molecular Formula | C21H18ClF3N2O4 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | [2-[[1-(3-chlorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate |
| SMILES | CCn1c(C(=O)NC(c2cccc(Cl)c2)C(F)(F)F)cc2cc(OC(=O)O)c(C)cc21 |
| InChI | InChI=1S/C21H18ClF3N2O4/c1-3-27-15-7-11(2)17(31-20(29)30)10-13(15)9-16(27)19(28)26-18(21(23,24)25)12-5-4-6-14(22)8-12/h4-10,18H,3H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | RVGPNGGBDMAJBT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|