C27H27ClN6O4S — CID 118040817
ethyl 3-[[2-[[4-[N'-(5-chlorothiophene-2-carbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate (PubChem CID 118040817) has the molecular formula C27H27ClN6O4S and a molecular weight of 567.07 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-[N'-(5-chlorothiophene-2-carbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-[N'-(5-chlorothiophene-2-carbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 118040817 |
| Molecular Formula | C27H27ClN6O4S |
| Molecular Weight | 567.07 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | ethyl 3-[[2-[[4-[N'-(5-chlorothiophene-2-carbonyl)carbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N/C(=O)c3ccc(Cl)s3)cc1)n2C |
| InChI | InChI=1S/C27H27ClN6O4S/c1-3-38-24(35)12-13-30-26(36)17-6-9-20-19(14-17)32-23(34(20)2)15-31-18-7-4-16(5-8-18)25(29)33-27(37)21-10-11-22(28)39-21/h4-11,14,31H,3,12-13,15H2,1-2H3,(H,30,36)(H2,29,33,37) |
| InChIKey | UTDGGWFZNZNNQS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.07 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|