About 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole
1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole (PubChem CID 118040877) has the molecular formula C16H16FN3S
and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole |
| PubChem CID | 118040877 |
| Molecular Formula | C16H16FN3S |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole |
| SMILES | CN1SN(CC2CC2)c2ccc(-c3cccnc3F)cc21 |
| InChI | InChI=1S/C16H16FN3S/c1-19-15-9-12(13-3-2-8-18-16(13)17)6-7-14(15)20(21-19)10-11-4-5-11/h2-3,6-9,11H,4-5,10H2,1H3 |
| InChIKey | LEPKPIHRPGPUQY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole?
The IUPAC name of 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole (CID 118040877) is 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole?
The canonical SMILES for 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole is CN1SN(CC2CC2)c2ccc(-c3cccnc3F)cc21.
What is the InChIKey of 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole?
The InChIKey is LEPKPIHRPGPUQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3S/c1-19-15-9-12(13-3-2-8-18-16(13)17)6-7-14(15)20(21-19)10-11-4-5-11/h2-3,6-9,11H,4-5,10H2,1H3.
What are the key properties of 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole?
1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole has a molecular weight of 301.39 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-5-(2-fluoro-3-pyridinyl)-3-methyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 118040877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).