C25H27N5O3S — CID 118041400
N-[(1S,2R)-2-[[6-[5-(dimethylsulfamoyl)-2-methylphenyl]quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide (PubChem CID 118041400) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[6-[5-(dimethylsulfamoyl)-2-methylphenyl]quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide.
| Compound Name | N-[(1S,2R)-2-[[6-[5-(dimethylsulfamoyl)-2-methylphenyl]quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
|---|---|
| PubChem CID | 118041400 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[(1S,2R)-2-[[6-[5-(dimethylsulfamoyl)-2-methylphenyl]quinazolin-2-yl]amino]cyclopentyl]prop-2-ynamide |
| SMILES | C#CC(=O)N[C@H]1CCC[C@H]1Nc1ncc2cc(-c3cc(S(=O)(=O)N(C)C)ccc3C)ccc2n1 |
| InChI | InChI=1S/C25H27N5O3S/c1-5-24(31)27-22-7-6-8-23(22)29-25-26-15-18-13-17(10-12-21(18)28-25)20-14-19(11-9-16(20)2)34(32,33)30(3)4/h1,9-15,22-23H,6-8H2,2-4H3,(H,27,31)(H,26,28,29)/t22-,23+/m0/s1 |
| InChIKey | MJKVLKWTLOAOJR-XZOQPEGZSA-N |
| XLogP | 2.94 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|