C20H36N5O4+ — CID 118041530
dimethyl-bis[3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propyl]azanium (PubChem CID 118041530) has the molecular formula C20H36N5O4+ and a molecular weight of 410.54 g/mol. Its IUPAC name is dimethyl-bis[3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propyl]azanium.
| Compound Name | dimethyl-bis[3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propyl]azanium |
|---|---|
| PubChem CID | 118041530 |
| Molecular Formula | C20H36N5O4+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | dimethyl-bis[3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propyl]azanium |
| SMILES | CN1C(=O)N(CCC[N+](C)(C)CCCN2C(=O)N(C)C(C)(C)C2=O)C(=O)C1(C)C |
| InChI | InChI=1S/C20H36N5O4/c1-19(2)15(26)23(17(28)21(19)5)11-9-13-25(7,8)14-10-12-24-16(27)20(3,4)22(6)18(24)29/h9-14H2,1-8H3/q+1 |
| InChIKey | QEPVADHEECVUKY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|