C27H42N7O6+ — CID 118041553
tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-prop-2-ynylazanium (PubChem CID 118041553) has the molecular formula C27H42N7O6+ and a molecular weight of 560.68 g/mol. Its IUPAC name is tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-prop-2-ynylazanium.
| Compound Name | tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 118041553 |
| Molecular Formula | C27H42N7O6+ |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](CCCN1C(=O)NC(C)(C)C1=O)(CCCN1C(=O)NC(C)(C)C1=O)CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C27H41N7O6/c1-8-15-34(16-9-12-31-19(35)25(2,3)28-22(31)38,17-10-13-32-20(36)26(4,5)29-23(32)39)18-11-14-33-21(37)27(6,7)30-24(33)40/h1H,9-18H2,2-7H3,(H2-,28,29,30,38,39,40)/p+1 |
| InChIKey | AVRWPLRKXWGMGR-UHFFFAOYSA-O |
| XLogP | 0.60 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|