C25H26N4O2 — CID 118041573
7-[(3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(1,3-dimethylpyrrolo[1,2-a]pyrazin-7-yl)chromen-2-one (PubChem CID 118041573) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 7-[(3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(1,3-dimethylpyrrolo[1,2-a]pyrazin-7-yl)chromen-2-one.
| Compound Name | 7-[(3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(1,3-dimethylpyrrolo[1,2-a]pyrazin-7-yl)chromen-2-one |
|---|---|
| PubChem CID | 118041573 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 7-[(3aR,6aR)-2-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-3-(1,3-dimethylpyrrolo[1,2-a]pyrazin-7-yl)chromen-2-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5C[C@H]6CC(C)N[C@H]6C5)cc4oc3=O)cc2c(C)n1 |
| InChI | InChI=1S/C25H26N4O2/c1-14-6-19-12-28(13-22(19)27-14)20-5-4-17-7-21(25(30)31-24(17)9-20)18-8-23-16(3)26-15(2)10-29(23)11-18/h4-5,7-11,14,19,22,27H,6,12-13H2,1-3H3/t14?,19-,22+/m1/s1 |
| InChIKey | OZKBKIAGMYAWMB-SVDVAIQXSA-N |
| XLogP | 3.91 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|