C16H10F4IN3O6S — CID 118041784
[1-(2-fluoro-4-iodophenyl)-3,8-dimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate (PubChem CID 118041784) has the molecular formula C16H10F4IN3O6S and a molecular weight of 575.23 g/mol. Its IUPAC name is [1-(2-fluoro-4-iodophenyl)-3,8-dimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate.
| Compound Name | [1-(2-fluoro-4-iodophenyl)-3,8-dimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118041784 |
| Molecular Formula | C16H10F4IN3O6S |
| Molecular Weight | 575.23 g/mol |
| Exact Mass | 574.93 |
| IUPAC Name | [1-(2-fluoro-4-iodophenyl)-3,8-dimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
| SMILES | Cn1c(=O)c2c(OS(=O)(=O)C(F)(F)F)cc(=O)n(C)c2n(-c2ccc(I)cc2F)c1=O |
| InChI | InChI=1S/C16H10F4IN3O6S/c1-22-11(25)6-10(30-31(28,29)16(18,19)20)12-13(22)24(15(27)23(2)14(12)26)9-4-3-7(21)5-8(9)17/h3-6H,1-2H3 |
| InChIKey | GHHIDFGKTXSAFP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|