C38H18Br8N4 — CID 118041847
5-[3-[3-[3,5-bis(4,6-dibromo-3-pyridinyl)phenyl]phenyl]-5-(4,6-dibromo-3-pyridinyl)phenyl]-2,4-dibromopyridine (PubChem CID 118041847) has the molecular formula C38H18Br8N4 and a molecular weight of 1169.82 g/mol. Its IUPAC name is 5-[3-[3-[3,5-bis(4,6-dibromo-3-pyridinyl)phenyl]phenyl]-5-(4,6-dibromo-3-pyridinyl)phenyl]-2,4-dibromopyridine.
| Compound Name | 5-[3-[3-[3,5-bis(4,6-dibromo-3-pyridinyl)phenyl]phenyl]-5-(4,6-dibromo-3-pyridinyl)phenyl]-2,4-dibromopyridine |
|---|---|
| PubChem CID | 118041847 |
| Molecular Formula | C38H18Br8N4 |
| Molecular Weight | 1169.82 g/mol |
| Exact Mass | 1161.50 |
| IUPAC Name | 5-[3-[3-[3,5-bis(4,6-dibromo-3-pyridinyl)phenyl]phenyl]-5-(4,6-dibromo-3-pyridinyl)phenyl]-2,4-dibromopyridine |
| SMILES | Brc1cc(Br)c(-c2cc(-c3cccc(-c4cc(-c5cnc(Br)cc5Br)cc(-c5cnc(Br)cc5Br)c4)c3)cc(-c3cnc(Br)cc3Br)c2)cn1 |
| InChI | InChI=1S/C38H18Br8N4/c39-31-11-35(43)47-15-27(31)23-5-21(6-24(9-23)28-16-48-36(44)12-32(28)40)19-2-1-3-20(4-19)22-7-25(29-17-49-37(45)13-33(29)41)10-26(8-22)30-18-50-38(46)14-34(30)42/h1-18H |
| InChIKey | KGSXJMNDCQTVBY-UHFFFAOYSA-N |
| XLogP | 15.37 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.82 |
| LogP ≤ 5 | 15.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|