C23H21N3O — CID 1180433
7-[(S)-(2,4-dimethylanilino)-pyridin-2-ylmethyl]quinolin-8-ol (PubChem CID 1180433) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 7-[(S)-(2,4-dimethylanilino)-pyridin-2-ylmethyl]quinolin-8-ol.
| Compound Name | 7-[(S)-(2,4-dimethylanilino)-pyridin-2-ylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 1180433 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 7-[(S)-(2,4-dimethylanilino)-pyridin-2-ylmethyl]quinolin-8-ol |
| SMILES | Cc1ccc(N[C@H](c2ccccn2)c2ccc3cccnc3c2O)c(C)c1 |
| InChI | InChI=1S/C23H21N3O/c1-15-8-11-19(16(2)14-15)26-22(20-7-3-4-12-24-20)18-10-9-17-6-5-13-25-21(17)23(18)27/h3-14,22,26-27H,1-2H3/t22-/m0/s1 |
| InChIKey | HNOOYYHKXONEOD-QFIPXVFZSA-N |
| XLogP | 5.15 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|