About 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one
3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one (PubChem CID 118045143) has the molecular formula C21H21N5O2
and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one.
Molecular Properties
| Compound Name | 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one |
| PubChem CID | 118045143 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one |
| SMILES | Cc1cn2cc(-c3cc4ccc(N5CCN(C)CC5)cc4c(=O)o3)nc2cn1 |
| InChI | InChI=1S/C21H21N5O2/c1-14-12-26-13-18(23-20(26)11-22-14)19-9-15-3-4-16(10-17(15)21(27)28-19)25-7-5-24(2)6-8-25/h3-4,9-13H,5-8H2,1-2H3 |
| InChIKey | VLDHIEYXICLZCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one?
The IUPAC name of 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one (CID 118045143) is 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one.
What is the SMILES notation for 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one?
The canonical SMILES for 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one is Cc1cn2cc(-c3cc4ccc(N5CCN(C)CC5)cc4c(=O)o3)nc2cn1.
What is the InChIKey of 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one?
The InChIKey is VLDHIEYXICLZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O2/c1-14-12-26-13-18(23-20(26)11-22-14)19-9-15-3-4-16(10-17(15)21(27)28-19)25-7-5-24(2)6-8-25/h3-4,9-13H,5-8H2,1-2H3.
What are the key properties of 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one?
3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one has a molecular weight of 375.43 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methylimidazo[1,2-a]pyrazin-2-yl)-7-(4-methylpiperazin-1-yl)isochromen-1-one is sourced from PubChem (CID 118045143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).