C13H29N3O — CID 118045164
2-[1-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol (PubChem CID 118045164) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[1-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol.
| Compound Name | 2-[1-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
|---|---|
| PubChem CID | 118045164 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2-[1-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethylamino]ethanol |
| SMILES | CC(NCCO)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H29N3O/c1-10(14-6-7-17)15-11-8-12(2,3)16-13(4,5)9-11/h10-11,14-17H,6-9H2,1-5H3 |
| InChIKey | HKMGQWYMIMYXOK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|