C25H26ClFN4O3 — CID 118045331
4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 118045331) has the molecular formula C25H26ClFN4O3 and a molecular weight of 484.96 g/mol. Its IUPAC name is 4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 118045331 |
| Molecular Formula | C25H26ClFN4O3 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | Nc1ncc(C2CCCC(O)C2)nc1-c1ccc(C(=O)N[C@H](CO)c2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C25H26ClFN4O3/c26-17-5-1-3-14(9-17)22(13-32)31-25(34)19-8-7-16(11-20(19)27)23-24(28)29-12-21(30-23)15-4-2-6-18(33)10-15/h1,3,5,7-9,11-12,15,18,22,32-33H,2,4,6,10,13H2,(H2,28,29)(H,31,34)/t15?,18?,22-/m1/s1 |
| InChIKey | LWSRMGOCEWXJAT-IVMBPFOVSA-N |
| XLogP | 4.00 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |