C27H29ClFN5O3 — CID 118045351
4-[6-(4-acetamidocyclohexyl)-3-aminopyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 118045351) has the molecular formula C27H29ClFN5O3 and a molecular weight of 526.01 g/mol. Its IUPAC name is 4-[6-(4-acetamidocyclohexyl)-3-aminopyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-[6-(4-acetamidocyclohexyl)-3-aminopyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 118045351 |
| Molecular Formula | C27H29ClFN5O3 |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 4-[6-(4-acetamidocyclohexyl)-3-aminopyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | CC(=O)NC1CCC(c2cnc(N)c(-c3ccc(C(=O)N[C@H](CO)c4cccc(Cl)c4)c(F)c3)n2)CC1 |
| InChI | InChI=1S/C27H29ClFN5O3/c1-15(36)32-20-8-5-16(6-9-20)23-13-31-26(30)25(33-23)18-7-10-21(22(29)12-18)27(37)34-24(14-35)17-3-2-4-19(28)11-17/h2-4,7,10-13,16,20,24,35H,5-6,8-9,14H2,1H3,(H2,30,31)(H,32,36)(H,34,37)/t16?,20?,24-/m1/s1 |
| InChIKey | RRWRVXZUHZDJJT-XWKHCGOCSA-N |
| XLogP | 4.14 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |