About tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate
tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate (PubChem CID 118045367) has the molecular formula C20H24FN3O3
and a molecular weight of 373.43 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate |
| PubChem CID | 118045367 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2nc([C@H]3CC[C@H](O)C3)cnc2N)cc1F |
| InChI | InChI=1S/C20H24FN3O3/c1-20(2,3)27-19(26)14-7-5-12(9-15(14)21)17-18(22)23-10-16(24-17)11-4-6-13(25)8-11/h5,7,9-11,13,25H,4,6,8H2,1-3H3,(H2,22,23)/t11-,13-/m0/s1 |
| InChIKey | DKRPUGLOCOUHRE-AAEUAGOBSA-N |
| XLogP | 3.45 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate?
The IUPAC name of tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate (CID 118045367) is tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate.
What is the SMILES notation for tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate?
The canonical SMILES for tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate is CC(C)(C)OC(=O)c1ccc(-c2nc([C@H]3CC[C@H](O)C3)cnc2N)cc1F.
What is the InChIKey of tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate?
The InChIKey is DKRPUGLOCOUHRE-AAEUAGOBSA-N. The full InChI is InChI=1S/C20H24FN3O3/c1-20(2,3)27-19(26)14-7-5-12(9-15(14)21)17-18(22)23-10-16(24-17)11-4-6-13(25)8-11/h5,7,9-11,13,25H,4,6,8H2,1-3H3,(H2,22,23)/t11-,13-/m0/s1.
What are the key properties of tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate?
tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate has a molecular weight of 373.43 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[3-amino-6-[(1S,3S)-3-hydroxycyclopentyl]pyrazin-2-yl]-2-fluorobenzoate is sourced from PubChem (CID 118045367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).