About 3-(6-amino-3-pyridinyl)pentane-1,5-diol
3-(6-amino-3-pyridinyl)pentane-1,5-diol (PubChem CID 118045558) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)pentane-1,5-diol.
Molecular Properties
| Compound Name | 3-(6-amino-3-pyridinyl)pentane-1,5-diol |
| PubChem CID | 118045558 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)pentane-1,5-diol |
| SMILES | Nc1ccc(C(CCO)CCO)cn1 |
| InChI | InChI=1S/C10H16N2O2/c11-10-2-1-9(7-12-10)8(3-5-13)4-6-14/h1-2,7-8,13-14H,3-6H2,(H2,11,12) |
| InChIKey | SEBBUGZHFGGSMJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-amino-3-pyridinyl)pentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-3-pyridinyl)pentane-1,5-diol?
The IUPAC name of 3-(6-amino-3-pyridinyl)pentane-1,5-diol (CID 118045558) is 3-(6-amino-3-pyridinyl)pentane-1,5-diol.
What is the SMILES notation for 3-(6-amino-3-pyridinyl)pentane-1,5-diol?
The canonical SMILES for 3-(6-amino-3-pyridinyl)pentane-1,5-diol is Nc1ccc(C(CCO)CCO)cn1.
What is the InChIKey of 3-(6-amino-3-pyridinyl)pentane-1,5-diol?
The InChIKey is SEBBUGZHFGGSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c11-10-2-1-9(7-12-10)8(3-5-13)4-6-14/h1-2,7-8,13-14H,3-6H2,(H2,11,12).
What are the key properties of 3-(6-amino-3-pyridinyl)pentane-1,5-diol?
3-(6-amino-3-pyridinyl)pentane-1,5-diol has a molecular weight of 196.25 g/mol, XLogP of 0.51, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-3-pyridinyl)pentane-1,5-diol is sourced from PubChem (CID 118045558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).