C10H16N2O2 — CID 118045558
3-(6-amino-3-pyridinyl)pentane-1,5-diol (PubChem CID 118045558) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)pentane-1,5-diol.
| Compound Name | 3-(6-amino-3-pyridinyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 118045558 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)pentane-1,5-diol |
| SMILES | Nc1ccc(C(CCO)CCO)cn1 |
| InChI | InChI=1S/C10H16N2O2/c11-10-2-1-9(7-12-10)8(3-5-13)4-6-14/h1-2,7-8,13-14H,3-6H2,(H2,11,12) |
| InChIKey | SEBBUGZHFGGSMJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |