C25H27ClFN5O2 — CID 118045718
N-[(1S)-2-amino-1-(3-chlorophenyl)ethyl]-4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-2-fluorobenzamide (PubChem CID 118045718) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is N-[(1S)-2-amino-1-(3-chlorophenyl)ethyl]-4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(1S)-2-amino-1-(3-chlorophenyl)ethyl]-4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 118045718 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[(1S)-2-amino-1-(3-chlorophenyl)ethyl]-4-[3-amino-6-(3-hydroxycyclohexyl)pyrazin-2-yl]-2-fluorobenzamide |
| SMILES | NC[C@@H](NC(=O)c1ccc(-c2nc(C3CCCC(O)C3)cnc2N)cc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27ClFN5O2/c26-17-5-1-3-14(9-17)21(12-28)32-25(34)19-8-7-16(11-20(19)27)23-24(29)30-13-22(31-23)15-4-2-6-18(33)10-15/h1,3,5,7-9,11,13,15,18,21,33H,2,4,6,10,12,28H2,(H2,29,30)(H,32,34)/t15?,18?,21-/m1/s1 |
| InChIKey | DCYFOJKSNVUYSX-ZYKWQNGHSA-N |
| XLogP | 3.97 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |