C24H20F3N3O4 — CID 118045782
4-[3-amino-6-(4-benzoyloxy-3,3-difluorocyclohexyl)pyrazin-2-yl]-2-fluorobenzoic acid (PubChem CID 118045782) has the molecular formula C24H20F3N3O4 and a molecular weight of 471.44 g/mol. Its IUPAC name is 4-[3-amino-6-(4-benzoyloxy-3,3-difluorocyclohexyl)pyrazin-2-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[3-amino-6-(4-benzoyloxy-3,3-difluorocyclohexyl)pyrazin-2-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118045782 |
| Molecular Formula | C24H20F3N3O4 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 4-[3-amino-6-(4-benzoyloxy-3,3-difluorocyclohexyl)pyrazin-2-yl]-2-fluorobenzoic acid |
| SMILES | Nc1ncc(C2CCC(OC(=O)c3ccccc3)C(F)(F)C2)nc1-c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C24H20F3N3O4/c25-17-10-14(6-8-16(17)22(31)32)20-21(28)29-12-18(30-20)15-7-9-19(24(26,27)11-15)34-23(33)13-4-2-1-3-5-13/h1-6,8,10,12,15,19H,7,9,11H2,(H2,28,29)(H,31,32) |
| InChIKey | HTSIIJRSGSHLBI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |