C14H14N4O2S — CID 118046282
N,N-dimethyl-6-spiro[4H-1,2,4-benzothiadiazine-3,3'-dioxirane]-2-ylpyridin-2-amine (PubChem CID 118046282) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N,N-dimethyl-6-spiro[4H-1,2,4-benzothiadiazine-3,3'-dioxirane]-2-ylpyridin-2-amine.
| Compound Name | N,N-dimethyl-6-spiro[4H-1,2,4-benzothiadiazine-3,3'-dioxirane]-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 118046282 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N,N-dimethyl-6-spiro[4H-1,2,4-benzothiadiazine-3,3'-dioxirane]-2-ylpyridin-2-amine |
| SMILES | CN(C)c1cccc(N2Sc3ccccc3NC23OO3)n1 |
| InChI | InChI=1S/C14H14N4O2S/c1-17(2)12-8-5-9-13(15-12)18-14(19-20-14)16-10-6-3-4-7-11(10)21-18/h3-9,16H,1-2H3 |
| InChIKey | PNEBJRFFKWNPGO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|