About 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione
12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione (PubChem CID 118047621) has the molecular formula C18H36N2O4
and a molecular weight of 344.50 g/mol. Its IUPAC name is 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione.
Molecular Properties
| Compound Name | 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione |
| PubChem CID | 118047621 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione |
| SMILES | CCNC(CCCC(O)C(O)CCCC(C)(NC)C(C)=O)C(C)=O |
| InChI | InChI=1S/C18H36N2O4/c1-6-20-15(13(2)21)9-7-10-16(23)17(24)11-8-12-18(4,19-5)14(3)22/h15-17,19-20,23-24H,6-12H2,1-5H3 |
| InChIKey | ORYQCMJAZDSPFE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione?
The IUPAC name of 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione (CID 118047621) is 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione.
What is the SMILES notation for 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione?
The canonical SMILES for 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione is CCNC(CCCC(O)C(O)CCCC(C)(NC)C(C)=O)C(C)=O.
What is the InChIKey of 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione?
The InChIKey is ORYQCMJAZDSPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O4/c1-6-20-15(13(2)21)9-7-10-16(23)17(24)11-8-12-18(4,19-5)14(3)22/h15-17,19-20,23-24H,6-12H2,1-5H3.
What are the key properties of 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione?
12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione has a molecular weight of 344.50 g/mol, XLogP of 1.18, 14 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(ethylamino)-7,8-dihydroxy-3-methyl-3-(methylamino)tetradecane-2,13-dione is sourced from PubChem (CID 118047621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).