About N,N-dimethylhexa-4,5-dienamide
N,N-dimethylhexa-4,5-dienamide (PubChem CID 11804836) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is N,N-dimethylhexa-4,5-dienamide.
Molecular Properties
| Compound Name | N,N-dimethylhexa-4,5-dienamide |
| PubChem CID | 11804836 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N,N-dimethylhexa-4,5-dienamide |
| SMILES | C=C=CCCC(=O)N(C)C |
| InChI | InChI=1S/C8H13NO/c1-4-5-6-7-8(10)9(2)3/h5H,1,6-7H2,2-3H3 |
| InChIKey | AEKPADGYPGWFMZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylhexa-4,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylhexa-4,5-dienamide?
The IUPAC name of N,N-dimethylhexa-4,5-dienamide (CID 11804836) is N,N-dimethylhexa-4,5-dienamide.
What is the SMILES notation for N,N-dimethylhexa-4,5-dienamide?
The canonical SMILES for N,N-dimethylhexa-4,5-dienamide is C=C=CCCC(=O)N(C)C.
What is the InChIKey of N,N-dimethylhexa-4,5-dienamide?
The InChIKey is AEKPADGYPGWFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-5-6-7-8(10)9(2)3/h5H,1,6-7H2,2-3H3.
What are the key properties of N,N-dimethylhexa-4,5-dienamide?
N,N-dimethylhexa-4,5-dienamide has a molecular weight of 139.20 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylhexa-4,5-dienamide is sourced from PubChem (CID 11804836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).